Online Database of Chemicals from Around the World
|
CAS#: 58802-20-3 Product: 1,2,7,8-Tetrachlorodibenzofuran No suppilers available for the product. |
| Name | 1,2,7,8-Tetrachlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,7,8-Tetrachloro; 1,2,7,8-Tcdf; Dibenzofuran, 1,2,7,8-Tetrachloro- |
| Molecular Structure |  |
| Molecular Formula | C12H4Cl4O |
| Molecular Weight | 305.98 |
| CAS Registry Number | 58802-20-3 |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)OC3=C2C(=C(C=C3)Cl)Cl |
| InChI | 1S/C12H4Cl4O/c13-6-1-2-9-11(12(6)16)5-3-7(14)8(15)4-10(5)17-9/h1-4H |
| InChIKey | JODWPAQNABOHDG-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.248°C at 760 mmHg (Cal.) |
| Flash point | 208.564°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,7,8-Tetrachlorodibenzofuran |