Online Database of Chemicals from Around the World
| Name | Bromopentakis(Bromomethyl)Benzene |
|---|---|
| Synonyms | Bromopentakis(Bromomethyl)Benzene |
| Molecular Structure |  |
| Molecular Formula | C11H10Br6 |
| Molecular Weight | 621.62 |
| CAS Registry Number | 58828-53-8 |
| EINECS | 261-465-5 |
| SMILES | C(C1=C(C(=C(C(=C1Br)CBr)CBr)CBr)CBr)Br |
| InChI | 1S/C11H10Br6/c12-1-6-7(2-13)9(4-15)11(17)10(5-16)8(6)3-14/h1-5H2 |
| InChIKey | FJBNKINHDKQRFO-UHFFFAOYSA-N |
| Density | 2.456g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.949°C at 760 mmHg (Cal.) |
| Flash point | 251.577°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bromopentakis(Bromomethyl)Benzene |
