Online Database of Chemicals from Around the World
|
CAS#: 58841-70-6 Product: 4,4''-Oxybis-1,1'-Biphenyl No suppilers available for the product. |
| Name | 4,4''-Oxybis-1,1'-Biphenyl |
|---|---|
| Synonyms | Diphenyl, Diphenyl Ether Mixtures; 1,1'-Biphenyl, 4,4''-Oxybis-; Diphenyl, Diphenyl Ether |
| Molecular Structure |  |
| Molecular Formula | C24H18O |
| Molecular Weight | 322.41 |
| CAS Registry Number | 58841-70-6 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2)OC3=CC=C(C=C3)C4=CC=CC=C4 |
| InChI | 1S/C24H18O/c1-3-7-19(8-4-1)21-11-15-23(16-12-21)25-24-17-13-22(14-18-24)20-9-5-2-6-10-20/h1-18H |
| InChIKey | YFIYNWHZXYZPDZ-UHFFFAOYSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 477.534°C at 760 mmHg (Cal.) |
| Flash point | 243.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4''-Oxybis-1,1'-Biphenyl |