Online Database of Chemicals from Around the World
|
CAS#: 58863-42-6 Product: Methyl 4-tert-butyldithiobenzoate No suppilers available for the product. |
| Name | Methyl 4-tert-butyldithiobenzoate |
|---|---|
| Synonyms | 4-Tert-Butylbenzenecarbodithioic Acid Methyl Ester; Benzenecarbodithioic Acid, 4-(1,1-Dimethylethyl)Methyl Ester; Methyl 4-Tert-Butyl-Dithiabenzoate |
| Molecular Structure |  |
| Molecular Formula | C12H16S2 |
| Molecular Weight | 224.38 |
| CAS Registry Number | 58863-42-6 |
| SMILES | C1=C(C=CC(=C1)C(C)(C)C)C(SC)=S |
| InChI | 1S/C12H16S2/c1-12(2,3)10-7-5-9(6-8-10)11(13)14-4/h5-8H,1-4H3 |
| InChIKey | XGVNDLXEGXTPBM-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 304.283°C at 760 mmHg (Cal.) |
| Flash point | 137.826°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-tert-butyldithiobenzoate |