| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Ryan Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 2,4-Dihydroxy-7-Methoxy-2H-1,4-Benzoxazin-3(4H)-One |
|---|---|
| Synonyms | 1,4-benzoxazin-3-one, 2,4-dihydroxy-7-methoxy-; 2,4-Dihydroxy-7-methoxy-1,4-benzoxazinone; 2,4-dihydroxy-7-methoxy-2H-benzo[e]1,4-oxazaperhydroin-3-one |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17 |
| CAS Registry Number | 588716-65-8 |
| SMILES | O=C1N(O)c2c(OC1O)cc(OC)cc2 |
| InChI | 1S/C9H9NO5/c1-14-5-2-3-6-7(4-5)15-9(12)8(11)10(6)13/h2-4,9,12-13H,1H3 |
| InChIKey | GDNZNIJPBQATCZ-UHFFFAOYSA-N |
| Density | 1.59g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.253°C at 760 mmHg (Cal.) |
| Flash point | 232.758°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| (1) | Francisco A. Macías, David Marín, Alberto Oliveros-Bastidas and José M. G. Molinillo. Rediscovering the bioactivity and ecological role of 1,4-benzoxazinones, Nat. Prod. Rep., 2009, 26, 478. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4-Dihydroxy-7-Methoxy-2H-1,4-Benzoxazin-3(4H)-One |