| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Classification | Biochemical >> Amino acids and their derivatives >> Tryptophan derivatives |
|---|---|
| Name | D-Tryptophanol Oxalate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15N2O |
| Molecular Weight | 191.25 |
| CAS Registry Number | 58889-66-0 |
| SMILES | [C@@H]([NH3+])(CC1=C[NH]C2=CC=CC=C12)CO |
| InChI | 1S/C11H14N2O/c12-9(7-14)5-8-6-13-11-4-2-1-3-10(8)11/h1-4,6,9,13-14H,5,7,12H2/p+1/t9-/m1/s1 |
| InChIKey | UDQCRUSSQAXPJY-SECBINFHSA-O |
| Boiling point | 444.238°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 222.467°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Tryptophanol Oxalate |