Online Database of Chemicals from Around the World
| Princeton BioMolecular Research, Inc. | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (732) 355-9920 | |||
 |
info@princetonbio.com | |||
| Chemical manufacturer since 1998 | ||||
| Name | 1-Butoxy-4-(2-Methyl-2-Propanyl)Benzene |
|---|---|
| Synonyms | Benzene,1-butoxy-4-(1,1-dimethylethyl)- |
| Molecular Structure |  |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32 |
| CAS Registry Number | 5891-68-9 |
| SMILES | O(c1ccc(cc1)C(C)(C)C)CCCC |
| InChI | 1S/C14H22O/c1-5-6-11-15-13-9-7-12(8-10-13)14(2,3)4/h7-10H,5-6,11H2,1-4H3 |
| InChIKey | WWVDEPVDRCEJLD-UHFFFAOYSA-N |
| Density | 0.898g/cm3 (Cal.) |
|---|---|
| Boiling point | 277.297°C at 760 mmHg (Cal.) |
| Flash point | 125.883°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Butoxy-4-(2-Methyl-2-Propanyl)Benzene |