|
CAS#: 5896-59-3 Product: 8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl 3,4-Dimethoxybenzoate No suppilers available for the product. |
| Name | 8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl 3,4-Dimethoxybenzoate |
|---|---|
| Synonyms | Convolamine; Convolanine hc1; C10854 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 |
| CAS Registry Number | 5896-59-3 |
| SMILES | O=C(OC2CC1N(C)C(CC1)C2)c3ccc(OC)c(OC)c3 |
| InChI | 1S/C17H23NO4/c1-18-12-5-6-13(18)10-14(9-12)22-17(19)11-4-7-15(20-2)16(8-11)21-3/h4,7-8,12-14H,5-6,9-10H2,1-3H3 |
| InChIKey | AEFPCFUCFQBXDQ-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.564°C at 760 mmHg (Cal.) |
| Flash point | 205.126°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl 3,4-Dimethoxybenzoate |