Online Database of Chemicals from Around the World
|
CAS#: 58976-65-1 Product: N,N-Bis(Carboxymethyl)-L-Glutamic Acid No suppilers available for the product. |
| Name | N,N-Bis(Carboxymethyl)-L-Glutamic Acid |
|---|---|
| Synonyms | 2-(Bis(Carboxymethyl)Amino)Glutaric Acid; N,N-Bis(Carboxymethyl)-L-Glutamic Acid |
| Molecular Structure |  |
| Molecular Formula | C9H13NO8 |
| Molecular Weight | 263.20 |
| CAS Registry Number | 58976-65-1 |
| EINECS | 261-530-8 |
| SMILES | C(N(C(C(=O)O)CCC(=O)O)CC(=O)O)C(=O)O |
| InChI | 1S/C9H13NO8/c11-6(12)2-1-5(9(17)18)10(3-7(13)14)4-8(15)16/h5H,1-4H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | VCVKIIDXVWEWSZ-UHFFFAOYSA-N |
| Density | 1.612g/cm3 (Cal.) |
|---|---|
| Boiling point | 587.087°C at 760 mmHg (Cal.) |
| Flash point | 308.86°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(Carboxymethyl)-L-Glutamic Acid |