Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Bromo-6-(Sulfamoylamino)Naphthalene |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H9BrN2O2S |
| Molecular Weight | 301.16 |
| CAS Registry Number | 590417-33-7 |
| SMILES | NS(=O)(=O)Nc1ccc2cc(Br)ccc2c1 |
| InChI | 1S/C10H9BrN2O2S/c11-9-3-1-8-6-10(13-16(12,14)15)4-2-7(8)5-9/h1-6,13H,(H2,12,14,15) |
| InChIKey | UDMXFSNFBFJUOG-UHFFFAOYSA-N |
| Density | 1.799g/cm3 (Cal.) |
|---|---|
| Boiling point | 486.522°C at 760 mmHg (Cal.) |
| Flash point | 248.04°C (Cal.) |
| Refractive index | 1.749 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-6-(Sulfamoylamino)Naphthalene |