Online Database of Chemicals from Around the World
|
CAS#: 59043-23-1 Product: (1S)-21-Norcycleanine No suppilers available for the product. |
| Name | (1S)-21-Norcycleanine |
|---|---|
| Synonyms | Sciadenine |
| Molecular Structure |  |
| Molecular Formula | C37H40N2O6 |
| Molecular Weight | 608.73 |
| CAS Registry Number | 59043-23-1 |
| SMILES | C1=C(OC)C(=C4C2=C1CCN(C2CC7=CC=C(OC3=C(C(=CC6=C3C(CC5=CC=C(O4)C=C5)N(CC6)C)OC)O)C=C7)C)OC |
| InChI | 1S/C37H40N2O6/c1-38-16-14-24-20-30(41-3)34(40)36-32(24)28(38)18-22-8-12-27(13-9-22)45-37-33-25(21-31(42-4)35(37)43-5)15-17-39(2)29(33)19-23-6-10-26(44-36)11-7-23/h6-13,20-21,28-29,40H,14-19H2,1-5H3 |
| InChIKey | KTAONUHTYCZKBS-UHFFFAOYSA-N |
| Density | 1.204g/cm3 (Cal.) |
|---|---|
| Boiling point | 690.11°C at 760 mmHg (Cal.) |
| Flash point | 371.165°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S)-21-Norcycleanine |