Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Chem Service, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (610) 692-3026 | |||
|
info@chemservice.com | |||
| Chemical manufacturer since 1962 | ||||
| Name | 2,4',5-Tribromobiphenyl |
|---|---|
| Synonyms | 2,4',5-Tribromobiphenyl; Inchi=1/C12h7br3/C13-9-3-1-8(2-4-9)11-7-10(14)5-6-12(11)15/H1-7; 2,4',5-Tribromo-1,1'-Biphenyl |
| Molecular Structure |  |
| Molecular Formula | C12H7Br3 |
| Molecular Weight | 390.90 |
| CAS Registry Number | 59080-36-3 |
| SMILES | C1=C(Br)C=CC(=C1C2=CC=C(C=C2)Br)Br |
| InChI | 1S/C12H7Br3/c13-9-3-1-8(2-4-9)11-7-10(14)5-6-12(11)15/h1-7H |
| InChIKey | VQAOFEQEGKHRBC-UHFFFAOYSA-N |
| Density | 1.923g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.495°C at 760 mmHg (Cal.) |
| Flash point | 176.902°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,4',5-Tribromobiphenyl |