Online Database of Chemicals from Around the World
|
CAS#: 59221-35-1 Product: N(epsilon)-Cbz-L-oxylysine No suppilers available for the product. |
| Name | N(epsilon)-Cbz-L-oxylysine |
|---|---|
| Synonyms | (2S)-2-Hydroxy-6-[[Oxo-(Phenylmethoxy)Methyl]Amino]Hexanoic Acid; (2S)-6-(Benzyloxycarbonylamino)-2-Hydroxy-Hexanoic Acid; N(Epsilon)-Cbz-L-Oxylysine |
| Molecular Structure |  |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 |
| CAS Registry Number | 59221-35-1 |
| SMILES | [C@@H](C(O)=O)(CCCCNC(=O)OCC1=CC=CC=C1)O |
| InChI | 1S/C14H19NO5/c16-12(13(17)18)8-4-5-9-15-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12,16H,4-5,8-10H2,(H,15,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | USGBKNFPBNWKDC-LBPRGKRZSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.521°C at 760 mmHg (Cal.) |
| Flash point | 269.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(epsilon)-Cbz-L-oxylysine |