Online Database of Chemicals from Around the World
|
CAS#: 59283-75-9 Product: 4-Hydroxylamino-2,6-Dinitrotoluene No suppilers available for the product. |
| Name | 4-Hydroxylamino-2,6-Dinitrotoluene |
|---|---|
| Synonyms | N-(4-Methyl-3,5-Dinitro-Phenyl)Hydroxylamine; 4-Hydroxylamino-1-Methyl-2,6-Dinitrobenzene; C16392 |
| Molecular Structure |  |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.15 |
| CAS Registry Number | 59283-75-9 |
| SMILES | C1=C(NO)C=C([N+]([O-])=O)C(=C1[N+]([O-])=O)C |
| InChI | 1S/C7H7N3O5/c1-4-6(9(12)13)2-5(8-11)3-7(4)10(14)15/h2-3,8,11H,1H3 |
| InChIKey | HTTDEAQRSCMCQS-UHFFFAOYSA-N |
| Density | 1.642g/cm3 (Cal.) |
|---|---|
| Boiling point | 343.822°C at 760 mmHg (Cal.) |
| Flash point | 161.738°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxylamino-2,6-Dinitrotoluene |