Online Database of Chemicals from Around the World
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (1457) 860-111 | |||
 |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Methyl 4,5-Diamino-o-Anisate |
|---|---|
| Synonyms | Methyl 4,5-Diamino-2-Methoxy-Benzoate; 4,5-Diamino-2-Methoxybenzoic Acid Methyl Ester; 4,5-Diamino-2-Methoxy-Benzoic Acid Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 |
| CAS Registry Number | 59338-85-1 |
| EINECS | 261-704-3 |
| SMILES | C1=C(C(=CC(=C1N)N)OC)C(OC)=O |
| InChI | 1S/C9H12N2O3/c1-13-8-4-7(11)6(10)3-5(8)9(12)14-2/h3-4H,10-11H2,1-2H3 |
| InChIKey | SUSCULWPEGQASI-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.95°C at 760 mmHg (Cal.) |
| Flash point | 242.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4,5-Diamino-o-Anisate |