Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4,5-Diamino-o-Anisic Acid |
|---|---|
| Synonyms | 4,5-Diamino-2-Methoxy-Benzoic Acid; 4,5-Diamino-O-Anisic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 |
| CAS Registry Number | 59338-91-9 |
| EINECS | 261-708-5 |
| SMILES | C1=C(C(=CC(=C1N)N)OC)C(=O)O |
| InChI | 1S/C8H10N2O3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,9-10H2,1H3,(H,11,12) |
| InChIKey | LYFZXIXVTGAHSZ-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.381°C at 760 mmHg (Cal.) |
| Flash point | 214.087°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Diamino-o-Anisic Acid |