Online Database of Chemicals from Around the World
|
CAS#: 595-17-5 Product: (3b,16b)-Olean-12-ene-3,16-diol No suppilers available for the product. |
| Name | (3b,16b)-Olean-12-ene-3,16-diol |
|---|---|
| Synonyms | Aids064684; Olean-12-Ene-3,16-Diol, (3Beta,16Beta)-; Maniladiol |
| Molecular Structure |  |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.72 |
| CAS Registry Number | 595-17-5 |
| SMILES | [C@@]13([C@]4(C(=CCC1[C@@]2([C@H](C([C@@H](O)CC2)(C)C)CC3)C)[C@H]5[C@@]([C@@H](O)C4)(CCC(C5)(C)C)C)C)C |
| InChI | 1S/C30H50O2/c1-25(2)15-16-27(5)20(17-25)19-9-10-22-28(6)13-12-23(31)26(3,4)21(28)11-14-29(22,7)30(19,8)18-24(27)32/h9,20-24,31-32H,10-18H2,1-8H3/t20-,21-,22?,23-,24-,27-,28-,29+,30+/m0/s1 |
| InChIKey | VLRYIIPJIVGFIV-XSDXNTANSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.684°C at 760 mmHg (Cal.) |
| Flash point | 210.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3b,16b)-Olean-12-ene-3,16-diol |