Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Benzyl 3-Aminopyrazinecarboxylate |
|---|---|
| Synonyms | 3-Amino-2-Pyrazinecarboxylic Acid Phenylmethyl Ester; 3-Aminopyrazinic Acid Benzyl Ester; Benzyl 3-Aminopyrazinecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 |
| CAS Registry Number | 59698-26-9 |
| EINECS | 261-864-4 |
| SMILES | C1=CN=C(C(=N1)C(OCC2=CC=CC=C2)=O)N |
| InChI | 1S/C12H11N3O2/c13-11-10(14-6-7-15-11)12(16)17-8-9-4-2-1-3-5-9/h1-7H,8H2,(H2,13,15) |
| InChIKey | VXRGDNBJXWLGIY-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.128°C at 760 mmHg (Cal.) |
| Flash point | 206.072°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzyl 3-Aminopyrazinecarboxylate |