Online Database of Chemicals from Around the World
|
CAS#: 5976-62-5 Product: 4-Hydroxyestrone-3-Methyl Ether No suppilers available for the product. |
| Name | 4-Hydroxyestrone-3-Methyl Ether |
|---|---|
| Synonyms | 4-08-00-02401 (Beilstein Handbook Reference); 4-Hydroxy-3-Methoxy-1,3,5(10)-Estratrien-17-One; 4-Hydroxyestrone-3-Methyl Ether |
| Molecular Structure |  |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 |
| CAS Registry Number | 5976-62-5 |
| SMILES | C1=CC(=C(C4=C1C3C(C2C(C(=O)CC2)(C)CC3)CC4)O)OC |
| InChI | 1S/C19H24O3/c1-19-10-9-12-11-5-7-16(22-2)18(21)14(11)4-3-13(12)15(19)6-8-17(19)20/h5,7,12-13,15,21H,3-4,6,8-10H2,1-2H3 |
| InChIKey | XITPEPUPAYFVDV-UHFFFAOYSA-N |
| Density | 1.173g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.542°C at 760 mmHg (Cal.) |
| Flash point | 160.813°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxyestrone-3-Methyl Ether |