Online Database of Chemicals from Around the World
|
CAS#: 5980-06-3 Product: Demethylcotinine No suppilers available for the product. |
| Name | Demethylcotinine |
|---|---|
| Synonyms | (5S)-5-(3-Pyridyl)Pyrrolidin-2-One; (5S)-5-(3-Pyridyl)-2-Pyrrolidinone; (5S)-5-(3-Pyridyl)-2-Pyrrolidone |
| Molecular Structure |  |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 |
| CAS Registry Number | 5980-06-3 |
| SMILES | [C@@H]1(NC(=O)CC1)C2=CC=CN=C2 |
| InChI | 1S/C9H10N2O/c12-9-4-3-8(11-9)7-2-1-5-10-6-7/h1-2,5-6,8H,3-4H2,(H,11,12)/t8-/m0/s1 |
| InChIKey | FXFANIORDKRCCA-QMMMGPOBSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.167°C at 760 mmHg (Cal.) |
| Flash point | 194.605°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Demethylcotinine |