Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Sigma-Aldrich, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+86 (21) 6141-5566 / 800-819-3336 | |||
|
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | (2-Chlorophenyl)(2,2,2-Trichloroethyl) Chlorophosphate |
|---|---|
| Synonyms | 1-Chloro-2-(Chloro-(2,2,2-Trichloroethoxy)Phosphoryl)Oxy-Benzene; 26033_Fluka; 2-Chlorophenyl 2,2,2-Trichloroethyl Chlorophosphate |
| Molecular Structure |  |
| Molecular Formula | C8H6Cl5O3P |
| Molecular Weight | 358.37 |
| CAS Registry Number | 59819-52-2 |
| EINECS | 261-939-1 |
| SMILES | C1=CC=CC(=C1O[P](OCC(Cl)(Cl)Cl)(=O)Cl)Cl |
| InChI | 1S/C8H6Cl5O3P/c9-6-3-1-2-4-7(6)16-17(13,14)15-5-8(10,11)12/h1-4H,5H2 |
| InChIKey | ORLCYMQZIPSODD-UHFFFAOYSA-N |
| Density | 1.644g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.663°C at 760 mmHg (Cal.) |
| Flash point | 260.313°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chlorophenyl)(2,2,2-Trichloroethyl) Chlorophosphate |