Online Database of Chemicals from Around the World
|
CAS#: 59823-94-8 Product: Europium(2+) Acetate No suppilers available for the product. |
| Name | Europium(2+) Acetate |
|---|---|
| Synonyms | Europium(+2) Cation Diethanoate; Acetic Acid, Europium(2+) Salt |
| Molecular Structure |  |
| Molecular Formula | C4H6EuO4 |
| Molecular Weight | 270.05 |
| CAS Registry Number | 59823-94-8 |
| EINECS | 261-941-2 |
| SMILES | [Eu++].CC([O-])=O.CC([O-])=O |
| InChI | 1S/2C2H4O2.Eu/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2 |
| InChIKey | JABSKJKXYGWLSD-UHFFFAOYSA-L |
| Boiling point | 117.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 40°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Europium(2+) Acetate |