|
CAS#: 5985-04-6 Product: Hydrohydrastinine Hydrochloride No suppilers available for the product. |
| Name | Hydrohydrastinine Hydrochloride |
|---|---|
| Synonyms | 1,3-Dioxolo(4,5-G)Isoquinoline, 5,6,7,8-Tetrahydro-6-Methyl-, Hydrochloride; Deoxyhydrastinine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 |
| CAS Registry Number | 5985-04-6 |
| EINECS | 227-802-5 |
| SMILES | C1=C3C(=CC2=C1CC[NH+](C2)C)OCO3.[Cl-] |
| InChI | 1S/C11H13NO2.ClH/c1-12-3-2-8-4-10-11(14-7-13-10)5-9(8)6-12;/h4-5H,2-3,6-7H2,1H3;1H |
| InChIKey | VVTDRPAONFOQAE-UHFFFAOYSA-N |
| Boiling point | 304°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 123°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hydrohydrastinine Hydrochloride |