|
CAS#: 59865-85-9 Product: 2-[(2-Chlorophenyl)Sulfonyl]Ethanethioamide No suppilers available for the product. |
| Name | 2-[(2-Chlorophenyl)Sulfonyl]Ethanethioamide |
|---|---|
| Synonyms | 2-(2-Chlorobenzenesulphonyl)thioacetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClNO2S2 |
| Molecular Weight | 249.74 |
| CAS Registry Number | 59865-85-9 |
| SMILES | c1ccc(c(c1)S(=O)(=O)CC(=S)N)Cl |
| InChI | 1S/C8H8ClNO2S2/c9-6-3-1-2-4-7(6)14(11,12)5-8(10)13/h1-4H,5H2,(H2,10,13) |
| InChIKey | JREIGMDAPLCMAE-UHFFFAOYSA-N |
| Density | 1.484g/cm3 (Cal.) |
|---|---|
| Boiling point | 462.967°C at 760 mmHg (Cal.) |
| Flash point | 233.794°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2-Chlorophenyl)Sulfonyl]Ethanethioamide |