Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2,3,4,4,5,6-Hexachloro-2,5-Cyclohexadien-1-One |
|---|---|
| Synonyms | 2,3,4,4,5,6-Hexachloro-1-Cyclohexa-2,5-Dienone; 2,3,4,4,5,6-Hexachlorcyklohexa-2,5-Dien-1-On [Czech]; 4-07-00-00289 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C6Cl6O |
| Molecular Weight | 300.78 |
| CAS Registry Number | 599-52-0 |
| SMILES | O=C1C(=C(Cl)C(Cl)(Cl)C(=C1Cl)Cl)Cl |
| InChI | 1S/C6Cl6O/c7-1-3(13)2(8)5(10)6(11,12)4(1)9 |
| InChIKey | SLKWROUNLHVIIQ-UHFFFAOYSA-N |
| Density | 1.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.587°C at 760 mmHg (Cal.) |
| Flash point | 134°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,4,4,5,6-Hexachloro-2,5-Cyclohexadien-1-One |