Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Methoxynaphtho[2,3-c]Furan-1,3-Dione |
|---|---|
| Synonyms | 6-methoxynaphtho[2,3-c]furan-1,3-dione |
| Molecular Structure | ![CAS#: 59922-33-7， 6-Methoxynaphtho[2,3-c]Furan-1,3-Dione](/moreStructures/59922-33-7.gif) |
| Molecular Formula | C13H8O4 |
| Molecular Weight | 228.20 |
| CAS Registry Number | 59922-33-7 |
| SMILES | O=C2OC(=O)c3cc1cc(OC)ccc1cc23 |
| InChI | 1S/C13H8O4/c1-16-9-3-2-7-5-10-11(6-8(7)4-9)13(15)17-12(10)14/h2-6H,1H3 |
| InChIKey | LTLFPBOXBQEHHO-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.501°C at 760 mmHg (Cal.) |
| Flash point | 198.192°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methoxynaphtho[2,3-c]Furan-1,3-Dione |