| Naturewill Biotechnology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.naturewillbio.com | |||
![]() | +86 (28) 8263-2533 | |||
![]() | info@naturewillbio.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2005 | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | Aegelinol |
|---|---|
| Synonyms | 3-hydroxy-2,2-dimethyl-3,4-dihydropyrano[3,2-g]chromen-8-one |
| Molecular Structure | ![]() |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 |
| CAS Registry Number | 5993-18-0 |
| SMILES | CC1(C(CC2=C(O1)C=C3C(=C2)C=CC(=O)O3)O)C |
| Solubility | 2102 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.592, Calc.* |
| Melting point | 148.89 °C |
| Boiling Point | 404.14 °C, 433.6±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 167.9±22.2 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Aegelinol |