Online Database of Chemicals from Around the World
|
CAS#: 59957-91-4 Product: 7,8,9,10-Tetrahydroxytetrahydrobenzo(a)Pyrene No suppilers available for the product. |
| Name | 7,8,9,10-Tetrahydroxytetrahydrobenzo(a)Pyrene |
|---|---|
| Synonyms | (+)-Trans-7,8,9,10-Tetrahydroxytetrahydrobenzo(A)Pyrene; (+/-)-7R,8T,9T,10C-Tetrahydroxy-7,8,9,10-Tetrahydrobenzo(A)Pyrene; 7,8,9,10-Tetrahydrobenzo(A)Pyrene-7,8,9,10-Tetrol |
| Molecular Structure |  |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 |
| CAS Registry Number | 59957-91-4 |
| SMILES | C1=C5C(=C4C2=C1C=CC3=C2C(=CC=C3)C=C4)C(O)C(C(C5O)O)O |
| InChI | 1S/C20H16O4/c21-17-13-8-11-5-4-9-2-1-3-10-6-7-12(15(11)14(9)10)16(13)18(22)20(24)19(17)23/h1-8,17-24H |
| InChIKey | KWFVZAJQUSRMCC-UHFFFAOYSA-N |
| Density | 1.628g/cm3 (Cal.) |
|---|---|
| Boiling point | 589.771°C at 760 mmHg (Cal.) |
| Flash point | 283.247°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,10-Tetrahydroxytetrahydrobenzo(a)Pyrene |