Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | N-Guanyltyramine |
|---|---|
| Synonyms | Guanidine, (2-(4-Hydroxyphenyl)Ethyl)-; N-Guanyltyramine; 1-(4-Hydroxyphenyl)-2-Guanidinoethane |
| Molecular Structure |  |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 |
| CAS Registry Number | 60-20-8 |
| SMILES | C1=C(CCN=C(N)N)C=CC(=C1)O |
| InChI | 1S/C9H13N3O/c10-9(11)12-6-5-7-1-3-8(13)4-2-7/h1-4,13H,5-6H2,(H4,10,11,12) |
| InChIKey | AQVMAAVRRJTLMJ-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.064°C at 760 mmHg (Cal.) |
| Flash point | 195.147°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Guanyltyramine |