Online Database of Chemicals from Around the World
|
CAS#: 60021-32-1 Product: 4-Hydroxyestriol No suppilers available for the product. |
| Name | 4-Hydroxyestriol |
|---|---|
| Synonyms | 4-Hydroxyestriol; Estra-1,3,5(10)-Triene-3,4,16,17-Tetrol, (16Alpha,17Beta)- |
| Molecular Structure |  |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 |
| CAS Registry Number | 60021-32-1 |
| SMILES | [C@H]34[C@H]1[C@@H](C2=C(CC1)C(=C(O)C=C2)O)CC[C@@]3([C@@H](O)[C@H](O)C4)C |
| InChI | 1S/C18H24O4/c1-18-7-6-10-9-4-5-14(19)16(21)12(9)3-2-11(10)13(18)8-15(20)17(18)22/h4-5,10-11,13,15,17,19-22H,2-3,6-8H2,1H3/t10-,11-,13+,15-,17+,18+/m1/s1 |
| InChIKey | KKXSCWWODCABHQ-OZPBLJIJSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 491.54°C at 760 mmHg (Cal.) |
| Flash point | 231.517°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Hydroxyestriol |