Online Database of Chemicals from Around the World
|
CAS#: 60050-33-1 Product: 2-(4-Fluorophenyl)-N-Methylsuccinimide No suppilers available for the product. |
| Name | 2-(4-Fluorophenyl)-N-Methylsuccinimide |
|---|---|
| Synonyms | 3-(3-Fluorophenyl)-1-Methyl-Pyrrolidine-2,5-Dione; 3-(3-Fluorophenyl)-1-Methyl-Pyrrolidine-2,5-Quinone; 2,5-Pyrrolidinedione, 3-(3-Fluorophenyl)-1-Methyl- (9Ci) |
| Molecular Structure |  |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 |
| CAS Registry Number | 60050-33-1 |
| SMILES | C1=CC=C(F)C=C1C2CC(N(C)C2=O)=O |
| InChI | 1S/C11H10FNO2/c1-13-10(14)6-9(11(13)15)7-3-2-4-8(12)5-7/h2-5,9H,6H2,1H3 |
| InChIKey | YZEWPKSQHDTNSU-UHFFFAOYSA-N |
| Density | 1.286g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.596°C at 760 mmHg (Cal.) |
| Flash point | 162.206°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Fluorophenyl)-N-Methylsuccinimide |