Online Database of Chemicals from Around the World
|
CAS#: 60066-83-3 Product: Ethyl (E)-6,6,6-Trichloro-3,3-Dimethyl-Hex-4-Enoate No suppilers available for the product. |
| Name | Ethyl (E)-6,6,6-Trichloro-3,3-Dimethyl-Hex-4-Enoate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C10H15Cl3O2 |
| Molecular Weight | 273.58 |
| CAS Registry Number | 60066-83-3 |
| SMILES | CC(C)(CC(=O)OCC)/C=C/C(Cl)(Cl)Cl |
| InChI | 1S/C10H15Cl3O2/c1-4-15-8(14)7-9(2,3)5-6-10(11,12)13/h5-6H,4,7H2,1-3H3/b6-5+ |
| InChIKey | YMXLOSPLQMWDAI-AATRIKPKSA-N |
| Density | 1.216g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.481°C at 760 mmHg (Cal.) |
| Flash point | 93.62°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (E)-6,6,6-Trichloro-3,3-Dimethyl-Hex-4-Enoate |