Online Database of Chemicals from Around the World
|
CAS#: 60132-69-6 Product: 5,2'-Dimethoxy-6,7-methylenedioxyflavanone No suppilers available for the product. |
| Name | 5,2'-Dimethoxy-6,7-methylenedioxyflavanone |
|---|---|
| Synonyms | 5,2'-Dimethoxy-6,7-Methylenedioxyflavanone; Betagarin; C09479 |
| Molecular Structure |  |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 |
| CAS Registry Number | 60132-69-6 |
| SMILES | [C@@H]3(OC2=CC1=C(OCO1)C(=C2C(=O)C3)OC)C4=CC=CC=C4OC |
| InChI | 1S/C18H16O6/c1-20-12-6-4-3-5-10(12)13-7-11(19)16-14(24-13)8-15-17(18(16)21-2)23-9-22-15/h3-6,8,13H,7,9H2,1-2H3/t13-/m0/s1 |
| InChIKey | IHPVFYLOGNNZLA-ZDUSSCGKSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 525.357°C at 760 mmHg (Cal.) |
| Flash point | 234.151°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,2'-Dimethoxy-6,7-methylenedioxyflavanone |