Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Dimethyl [(1R,2R)-2-Ethylcyclopentyl]Boronate |
|---|---|
| Synonyms | dimethyl ((1R,2R)-2-ethylcyclopentyl)boronate |
| Molecular Structure | ![CAS#: 60134-95-4， Dimethyl [(1R,2R)-2-Ethylcyclopentyl]Boronate](/moreStructures/60134-95-4.gif) |
| Molecular Formula | C9H19BO2 |
| Molecular Weight | 170.06 |
| CAS Registry Number | 60134-95-4 |
| SMILES | B([C@@H]1CCC[C@H]1CC)(OC)OC |
| InChI | 1S/C9H19BO2/c1-4-8-6-5-7-9(8)10(11-2)12-3/h8-9H,4-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | HTJLOXDFKAFZGW-RKDXNWHRSA-N |
| Density | 0.874g/cm3 (Cal.) |
|---|---|
| Boiling point | 171.593°C at 760 mmHg (Cal.) |
| Flash point | 57.578°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl [(1R,2R)-2-Ethylcyclopentyl]Boronate |