| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.fine-chemtech.com | |||
![]() | +86 (25) 5207-8417 +86 17714198479 | |||
![]() | +86 (25) 5207-8417 | |||
![]() | sales@fine-chemtech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Name | N-(5-ethyl-2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H14F3NO |
| Molecular Weight | 257.25 |
| CAS Registry Number | 601487-88-1 |
| SMILES | CCC1=CC2=C(CC(C2)NC(=O)C(F)(F)F)C=C1 |
| Solubility | 9.041 mg/L (25 °C water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.504, Calc.* |
| Melting point | 126.26 °C |
| Boiling Point | 357.74 °C, 344.8±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 162.4±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-(5-ethyl-2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide |