| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.fine-chemtech.com | |||
![]() | +86 (25) 5207-8417 +86 17714198479 | |||
![]() | +86 (25) 5207-8417 | |||
![]() | sales@fine-chemtech.com | |||
![]() | QQ Chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink Standard supplier since 2007 | ||||
| Name | N-(5-acetyl-6-ethyl-2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 |
| CAS Registry Number | 601487-89-2 |
| SMILES | CCC1=C(C=C2CC(CC2=C1)NC(=O)C(F)(F)F)C(=O)C |
| Solubility | 9.743 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.511, Calc.* |
| Melting point | 164.69 °C |
| Boiling Point | 403.60 °C, 435.5±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 217.2±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for N-(5-acetyl-6-ethyl-2,3-dihydro-1H-inden-2-yl)-2,2,2-trifluoroacetamide |