Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,1,1,3,10,11-Hexachloroundecane |
|---|---|
| Synonyms | 1,1,1,3,10,11-Hexachloroundecane; 1,1,1,3,10,11-Hexachloroundécane; 1,1,1,3,10,11-Hexachlorundecan |
| Molecular Structure |  |
| Molecular Formula | C11H18Cl6 |
| Molecular Weight | 362.98 |
| CAS Registry Number | 601523-28-8 |
| SMILES | C(CCCC(CCl)Cl)CCC(CC(Cl)(Cl)Cl)Cl |
| InChI | 1S/C11H18Cl6/c12-8-10(14)6-4-2-1-3-5-9(13)7-11(15,16)17/h9-10H,1-8H2 |
| InChIKey | BGUCVTBWQJKWCX-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.5±10.0°C at 760 mmHg (Cal.) |
| Flash point | 176.1±16.4°C (Cal.) |
| Refractive index | 1.499 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,10,11-Hexachloroundecane |