|
CAS#: 60189-44-8 Product: Alanylproline 4-Nitroanilide No suppilers available for the product. |
| Name | Alanylproline 4-Nitroanilide |
|---|---|
| Synonyms | (2S)-N-[(2S)-2-Amino-1-Oxopropyl]-1-(4-Nitrophenyl)-2-Pyrrolidinecarboxamide; (2S)-N-Alanyl-1-(4-Nitrophenyl)Pyrrolidine-2-Carboxamide; Appna |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18N4O4 |
| Molecular Weight | 306.32 |
| CAS Registry Number | 60189-44-8 |
| SMILES | [C@@H]2(N(C1=CC=C([N+]([O-])=O)C=C1)CCC2)C(=O)NC(=O)[C@@H](N)C |
| InChI | 1S/C14H18N4O4/c1-9(15)13(19)16-14(20)12-3-2-8-17(12)10-4-6-11(7-5-10)18(21)22/h4-7,9,12H,2-3,8,15H2,1H3,(H,16,19,20)/t9-,12-/m0/s1 |
| InChIKey | UGYPXDYOSJWGPL-CABZTGNLSA-N |
| Density | 1.331g/cm3 (Cal.) |
|---|---|
| Boiling point | 551.479°C at 760 mmHg (Cal.) |
| Flash point | 287.324°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Alanylproline 4-Nitroanilide |