| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| Name | Valoneic Acid Dilactone |
|---|---|
| Synonyms | Valoneic acid bilactone |
| Molecular Structure | ![]() |
| Molecular Formula | C21H10O13 |
| Molecular Weight | 470.30 |
| CAS Registry Number | 60202-70-2 |
| SMILES | C1=C2C3=C(C(=C1O)O)OC(=O)C4=CC(=C(C(=C43)OC2=O)O)OC5=C(C(=C(C=C5C(=O)O)O)O)O |
| InChI | 1S/C21H10O13/c22-7-2-6(19(28)29)16(15(27)12(7)24)32-9-3-5-11-10-4(20(30)34-18(11)14(9)26)1-8(23)13(25)17(10)33-21(5)31/h1-3,22-27H,(H,28,29) |
| InChIKey | BPAOAXAAABIQKR-UHFFFAOYSA-N |
| solubility | Soluble in methanol and DMSO. Insoluble in hexane |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Valoneic Acid Dilactone |