Online Database of Chemicals from Around the World
|
CAS#: 6022-33-9 Product: 1-Chloro-N'-(3,4-dichlorophenyl)-N,N-dimethylformamidine No suppilers available for the product. |
| Name | 1-Chloro-N'-(3,4-dichlorophenyl)-N,N-dimethylformamidine |
|---|---|
| Synonyms | 1-Chloro-N'-(3,4-Dichlorophenyl)-N,N-Dimethyl-Formamidine; 1-Chloro-N'-(3,4-Dichlorophenyl)-N,N-Dimethylformamidine; 1-Chloro-N'-(3,4-Dichlorophenyl)-N,N-Dimethyl-Methanimidamide |
| Molecular Structure |  |
| Molecular Formula | C9H9Cl3N2 |
| Molecular Weight | 251.54 |
| CAS Registry Number | 6022-33-9 |
| SMILES | C1=C(N=C(N(C)C)Cl)C=CC(=C1Cl)Cl |
| InChI | 1S/C9H9Cl3N2/c1-14(2)9(12)13-6-3-4-7(10)8(11)5-6/h3-5H,1-2H3 |
| InChIKey | WKQYAIDXQNGNIQ-UHFFFAOYSA-N |
| Density | 1.319g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.749°C at 760 mmHg (Cal.) |
| Flash point | 153.832°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-N'-(3,4-dichlorophenyl)-N,N-dimethylformamidine |