Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(3-Acetylphenyl)-2,2,2-Trifluoroethanone |
|---|---|
| Synonyms | 1-(3-acetylphenyl)-2,2,2-trifluoroethanone |
| Molecular Structure |  |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 |
| CAS Registry Number | 60283-15-0 |
| SMILES | CC(=O)c1cccc(c1)C(=O)C(F)(F)F |
| InChI | 1S/C10H7F3O2/c1-6(14)7-3-2-4-8(5-7)9(15)10(11,12)13/h2-5H,1H3 |
| InChIKey | DNFHMFVTDVWIGG-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 271.54°C at 760 mmHg (Cal.) |
| Flash point | 94.77°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3-Acetylphenyl)-2,2,2-Trifluoroethanone |