Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-(2,4-Dichlorophenyl)-4-methylpyrrolidine |
|---|---|
| Synonyms | 2-(2,4-dichlorophenyl)-4-methylpyrrolidine |
| Molecular Structure |  |
| Molecular Formula | C11H13Cl2N |
| Molecular Weight | 230.13 |
| CAS Registry Number | 603068-14-0 |
| SMILES | Clc1cc(Cl)c(cc1)C2NCC(C)C2 |
| InChI | rd-copy-button" onmouseover="ClipboardCopyInit(this, |
| Density | 1.193g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.155°C at 760 mmHg (Cal.) |
| Flash point | 130.491°C (Cal.) |
| Refractive index | 1.543 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2,4-Dichlorophenyl)-4-methylpyrrolidine |