Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Methyl-2-[3-(trifluoromethyl)phenyl]pyrrolidine |
|---|---|
| Synonyms | 4-methyl-2-(3-(trifluoromethyl)phenyl)pyrrolidine |
| Molecular Structure | ![CAS#: 603068-25-3， 4-Methyl-2-[3-(trifluoromethyl)phenyl]pyrrolidine](/moreStructures/603068-25-3.gif) |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 |
| CAS Registry Number | 603068-25-3 |
| SMILES | FC(F)(F)c1cc(ccc1)C2NCC(C)C2 |
| InChI | 1S/C12H14F3N/c1-8-5-11(16-7-8)9-3-2-4-10(6-9)12(13,14)15/h2-4,6,8,11,16H,5,7H2,1H3 |
| InChIKey | JTZYDTCIMTXLFH-UHFFFAOYSA-N |
| Density | 1.132g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.337°C at 760 mmHg (Cal.) |
| Flash point | 102.781°C (Cal.) |
| Refractive index | 1.465 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Methyl-2-[3-(trifluoromethyl)phenyl]pyrrolidine |