Online Database of Chemicals from Around the World
|
CAS#: 603106-30-5 Product: 3-Methoxy-5-methylphenylalanine No suppilers available for the product. |
| Name | 3-Methoxy-5-methylphenylalanine |
|---|---|
| Synonyms | DL-3-Methoxy-5-methylphenylalanine |
| Molecular Structure |  |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 |
| CAS Registry Number | 603106-30-5 |
| SMILES | O=C(O)C(N)Cc1cc(cc(OC)c1)C |
| InChI | 1S/C11H15NO3/c1-7-3-8(5-9(4-7)15-2)6-10(12)11(13)14/h3-5,10H,6,12H2,1-2H3,(H,13,14) |
| InChIKey | OZKDWYNFJZZYAB-UHFFFAOYSA-N |
| Density | 1.177g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.217°C at 760 mmHg (Cal.) |
| Flash point | 175.887°C (Cal.) |
| Refractive index | 1.554 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methoxy-5-methylphenylalanine |