Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 4-Chloro-3-Hydroxyphenylacetic Acid |
|---|---|
| Synonyms | 2-(4-Chloro-3-Hydroxy-Phenyl)Acetic Acid; 2-(4-Chloro-3-Hydroxy-Phenyl)Ethanoic Acid; 4-Chloro-3-Hydroxyphenylacetic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H7ClO3 |
| Molecular Weight | 186.59 |
| CAS Registry Number | 60397-70-8 |
| SMILES | C1=C(CC(=O)O)C=CC(=C1O)Cl |
| InChI | 1S/C8H7ClO3/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,10H,4H2,(H,11,12) |
| InChIKey | RJTRVMKQVDAYDG-UHFFFAOYSA-N |
| Density | 1.466g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.744°C at 760 mmHg (Cal.) |
| Flash point | 165.924°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-3-Hydroxyphenylacetic Acid |