Online Database of Chemicals from Around the World
|
CAS#: 605-28-7 Product: 2,7-Dinitroanthraquinone No suppilers available for the product. |
| Name | 2,7-Dinitroanthraquinone |
|---|---|
| Synonyms | 2,7-Dinitro-9,10-Anthraquinone; 2,7-Dinitroanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H6N2O6 |
| Molecular Weight | 298.21 |
| CAS Registry Number | 605-28-7 |
| EINECS | 210-084-2 |
| SMILES | C1=C2C(=CC=C1[N+]([O-])=O)C(=O)C3=C(C2=O)C=C([N+]([O-])=O)C=C3 |
| InChI | 1S/C14H6N2O6/c17-13-9-3-1-7(15(19)20)5-11(9)14(18)12-6-8(16(21)22)2-4-10(12)13/h1-6H |
| InChIKey | XFLONXIGNOXKCG-UHFFFAOYSA-N |
| Density | 1.632g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.377°C at 760 mmHg (Cal.) |
| Flash point | 294.024°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,7-Dinitroanthraquinone |