Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,5-Naphthylene Di(Acetate) |
|---|---|
| Synonyms | (5-Acetoxy-1-Naphthyl) Acetate; Acetic Acid (5-Acetoxy-1-Naphthyl) Ester; (5-Acetyloxynaphthalen-1-Yl) Ethanoate |
| Molecular Structure |  |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 605-89-0 |
| EINECS | 210-098-9 |
| SMILES | C1=CC=C(OC(=O)C)C2=C1C(=CC=C2)OC(=O)C |
| InChI | 1S/C14H12O4/c1-9(15)17-13-7-3-6-12-11(13)5-4-8-14(12)18-10(2)16/h3-8H,1-2H3 |
| InChIKey | OZXMAFKBBGXKSP-UHFFFAOYSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.464°C at 760 mmHg (Cal.) |
| Flash point | 196.213°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Naphthylene Di(Acetate) |