Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-Methylisocitric acid |
|---|---|
| Synonyms | (2R,3S)2-Methylisocitrate; Cpd-618; 1,2,3-Butanetricarboxylic Acid, 3-Hydroxy- |
| Molecular Structure |  |
| Molecular Formula | C7H10O7 |
| Molecular Weight | 206.15 |
| CAS Registry Number | 6061-95-6 |
| SMILES | C(C(C(O)(C)C(O)=O)C(O)=O)C(O)=O |
| InChI | 1S/C7H10O7/c1-7(14,6(12)13)3(5(10)11)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13) |
| InChIKey | HHKPKXCSHMJWCF-UHFFFAOYSA-N |
| Density | 1.638g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.982°C at 760 mmHg (Cal.) |
| Flash point | 168.18°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methylisocitric acid |