Online Database of Chemicals from Around the World
|
CAS#: 60640-57-5 Product: 2,5,2',5'-Tetrachloro-4-Methylthiobiphenyl No suppilers available for the product. |
| Name | 2,5,2',5'-Tetrachloro-4-Methylthiobiphenyl |
|---|---|
| Synonyms | 1,4-Dichloro-2-(2,5-Dichlorophenyl)-5-Methylsulfanyl-Benzene; 1,4-Dichloro-2-(2,5-Dichlorophenyl)-5-(Methylthio)Benzene; 1,1'-Biphenyl, 2,2',5,5'-Tetrachloro-4-(Methylthio)- |
| Molecular Structure |  |
| Molecular Formula | C13H8Cl4S |
| Molecular Weight | 338.08 |
| CAS Registry Number | 60640-57-5 |
| SMILES | C1=C(C(=CC(=C1SC)Cl)C2=CC(=CC=C2Cl)Cl)Cl |
| InChI | 1S/C13H8Cl4S/c1-18-13-6-11(16)9(5-12(13)17)8-4-7(14)2-3-10(8)15/h2-6H,1H3 |
| InChIKey | LUZWJARHZJMSDU-UHFFFAOYSA-N |
| Density | 1.505g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.495°C at 760 mmHg (Cal.) |
| Flash point | 174.726°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5,2',5'-Tetrachloro-4-Methylthiobiphenyl |