Online Database of Chemicals from Around the World
|
CAS#: 6065-08-3 Product: 4-Nitro-3-Octene No suppilers available for the product. |
| Name | 4-Nitro-3-Octene |
|---|---|
| Synonyms | 4-Nitro-3-Octene; Brn 1841207; 3-Octene, 4-Nitro- |
| Molecular Structure |  |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 6065-08-3 |
| SMILES | C(\C([N+]([O-])=O)=C\CC)CCC |
| InChI | 1S/C8H15NO2/c1-3-5-7-8(6-4-2)9(10)11/h6H,3-5,7H2,1-2H3/b8-6- |
| InChIKey | FRRMNZJEBDKMAF-VURMDHGXSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 228.283°C at 760 mmHg (Cal.) |
| Flash point | 83.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-3-Octene |